About N,N'-bis(prop-2-enyl)butane-1,4-diamine;phosphoric acid
N,N'-bis(prop-2-enyl)butane-1,4-diamine;phosphoric acid (PubChem CID 86643588) has the molecular formula C10H23N2O4P
and a molecular weight of 266.28 g/mol. Its IUPAC name is N,N'-bis(prop-2-enyl)butane-1,4-diamine;phosphoric acid.
Molecular Properties
| Compound Name | N,N'-bis(prop-2-enyl)butane-1,4-diamine;phosphoric acid |
| PubChem CID | 86643588 |
| Molecular Formula | C10H23N2O4P |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N,N'-bis(prop-2-enyl)butane-1,4-diamine;phosphoric acid |
| SMILES | C=CCNCCCCNCC=C.O=P(O)(O)O |
| InChI | InChI=1S/C10H20N2.H3O4P/c1-3-7-11-9-5-6-10-12-8-4-2;1-5(2,3)4/h3-4,11-12H,1-2,5-10H2;(H3,1,2,3,4) |
| InChIKey | JPFXJOQPNNMDRR-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(prop-2-enyl)butane-1,4-diamine;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(prop-2-enyl)butane-1,4-diamine;phosphoric acid?
The IUPAC name of N,N'-bis(prop-2-enyl)butane-1,4-diamine;phosphoric acid (CID 86643588) is N,N'-bis(prop-2-enyl)butane-1,4-diamine;phosphoric acid.
What is the SMILES notation for N,N'-bis(prop-2-enyl)butane-1,4-diamine;phosphoric acid?
The canonical SMILES for N,N'-bis(prop-2-enyl)butane-1,4-diamine;phosphoric acid is C=CCNCCCCNCC=C.O=P(O)(O)O.
What is the InChIKey of N,N'-bis(prop-2-enyl)butane-1,4-diamine;phosphoric acid?
The InChIKey is JPFXJOQPNNMDRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2.H3O4P/c1-3-7-11-9-5-6-10-12-8-4-2;1-5(2,3)4/h3-4,11-12H,1-2,5-10H2;(H3,1,2,3,4).
What are the key properties of N,N'-bis(prop-2-enyl)butane-1,4-diamine;phosphoric acid?
N,N'-bis(prop-2-enyl)butane-1,4-diamine;phosphoric acid has a molecular weight of 266.28 g/mol, XLogP of 0.39, 9 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(prop-2-enyl)butane-1,4-diamine;phosphoric acid is sourced from PubChem (CID 86643588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).