C10H6F5NOS — CID 86643617
1-isothiocyanato-4-(2,2,3,3,3-pentafluoropropoxy)benzene (PubChem CID 86643617) has the molecular formula C10H6F5NOS and a molecular weight of 283.22 g/mol. Its IUPAC name is 1-isothiocyanato-4-(2,2,3,3,3-pentafluoropropoxy)benzene.
| Compound Name | 1-isothiocyanato-4-(2,2,3,3,3-pentafluoropropoxy)benzene |
|---|---|
| PubChem CID | 86643617 |
| Molecular Formula | C10H6F5NOS |
| Molecular Weight | 283.22 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 1-isothiocyanato-4-(2,2,3,3,3-pentafluoropropoxy)benzene |
| SMILES | FC(F)(F)C(F)(F)COc1ccc(N=C=S)cc1 |
| InChI | InChI=1S/C10H6F5NOS/c11-9(12,10(13,14)15)5-17-8-3-1-7(2-4-8)16-6-18/h1-4H,5H2 |
| InChIKey | HPTMRBCHASDUSB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.22 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|