C19H20F3N3O3S — CID 86643621
ethyl 4-cyclopropyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]carbamothioylamino]-1H-pyrrole-2-carboxylate (PubChem CID 86643621) has the molecular formula C19H20F3N3O3S and a molecular weight of 427.45 g/mol. Its IUPAC name is ethyl 4-cyclopropyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]carbamothioylamino]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-cyclopropyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]carbamothioylamino]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 86643621 |
| Molecular Formula | C19H20F3N3O3S |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | ethyl 4-cyclopropyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]carbamothioylamino]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]cc(C2CC2)c1NC(=S)Nc1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H20F3N3O3S/c1-2-27-17(26)16-15(14(9-23-16)11-3-4-11)25-18(29)24-12-5-7-13(8-6-12)28-10-19(20,21)22/h5-9,11,23H,2-4,10H2,1H3,(H2,24,25,29) |
| InChIKey | MXQCKTMEIYKKML-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|