C22H20ClN5OS — CID 86643696
8-[3-(2-chloro-4-pyridinyl)phenyl]-13-methylsulfanyl-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one (PubChem CID 86643696) has the molecular formula C22H20ClN5OS and a molecular weight of 437.96 g/mol. Its IUPAC name is 8-[3-(2-chloro-4-pyridinyl)phenyl]-13-methylsulfanyl-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one.
| Compound Name | 8-[3-(2-chloro-4-pyridinyl)phenyl]-13-methylsulfanyl-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
|---|---|
| PubChem CID | 86643696 |
| Molecular Formula | C22H20ClN5OS |
| Molecular Weight | 437.96 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 8-[3-(2-chloro-4-pyridinyl)phenyl]-13-methylsulfanyl-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
| SMILES | CSc1ncc2c(n1)N1CCCC1CN(c1cccc(-c3ccnc(Cl)c3)c1)C2=O |
| InChI | InChI=1S/C22H20ClN5OS/c1-30-22-25-12-18-20(26-22)27-9-3-6-17(27)13-28(21(18)29)16-5-2-4-14(10-16)15-7-8-24-19(23)11-15/h2,4-5,7-8,10-12,17H,3,6,9,13H2,1H3 |
| InChIKey | IJDDPVQGCQIZLZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.96 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|