methyl 6-bromo-3-(4-fluorophenyl)sulfanylpyrazine-2-carboxylate

C12H8BrFN2O2S — CID 86643719

IUPACmethyl 6-bromo-3-(4-fluorophenyl)sulfanylpyrazine-2-carboxylate
SMILESCOC(=O)c1nc(Br)cnc1Sc1ccc(F)cc1
InChIInChI=1S/C12H8BrFN2O2S/c1-18-12(17)10-11(15-6-9(13)16-10)19-8-4-2-7(14)3-5-8/h2-6H,1H3
InChIKeyWPJODFCXWODHPI-UHFFFAOYSA-N
MW343.18 g/mol
LogP3.32
Rot. Bonds3

About methyl 6-bromo-3-(4-fluorophenyl)sulfanylpyrazine-2-carboxylate

methyl 6-bromo-3-(4-fluorophenyl)sulfanylpyrazine-2-carboxylate (PubChem CID 86643719) has the molecular formula C12H8BrFN2O2S and a molecular weight of 343.18 g/mol. Its IUPAC name is methyl 6-bromo-3-(4-fluorophenyl)sulfanylpyrazine-2-carboxylate.

Molecular Properties

Compound Namemethyl 6-bromo-3-(4-fluorophenyl)sulfanylpyrazine-2-carboxylate
PubChem CID86643719
Molecular FormulaC12H8BrFN2O2S
Molecular Weight343.18 g/mol
Exact Mass341.95
IUPAC Namemethyl 6-bromo-3-(4-fluorophenyl)sulfanylpyrazine-2-carboxylate
SMILESCOC(=O)c1nc(Br)cnc1Sc1ccc(F)cc1
InChIInChI=1S/C12H8BrFN2O2S/c1-18-12(17)10-11(15-6-9(13)16-10)19-8-4-2-7(14)3-5-8/h2-6H,1H3
InChIKeyWPJODFCXWODHPI-UHFFFAOYSA-N
XLogP3.32
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500343.18
LogP ≤ 53.32
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 6-bromo-3-(4-fluorophenyl)sulfanylpyrazine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-bromo-3-(4-fluorophenyl)sulfanylpyrazine-2-carboxylate?
The IUPAC name of methyl 6-bromo-3-(4-fluorophenyl)sulfanylpyrazine-2-carboxylate (CID 86643719) is methyl 6-bromo-3-(4-fluorophenyl)sulfanylpyrazine-2-carboxylate.
What is the SMILES notation for methyl 6-bromo-3-(4-fluorophenyl)sulfanylpyrazine-2-carboxylate?
The canonical SMILES for methyl 6-bromo-3-(4-fluorophenyl)sulfanylpyrazine-2-carboxylate is COC(=O)c1nc(Br)cnc1Sc1ccc(F)cc1.
What is the InChIKey of methyl 6-bromo-3-(4-fluorophenyl)sulfanylpyrazine-2-carboxylate?
The InChIKey is WPJODFCXWODHPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrFN2O2S/c1-18-12(17)10-11(15-6-9(13)16-10)19-8-4-2-7(14)3-5-8/h2-6H,1H3.
What are the key properties of methyl 6-bromo-3-(4-fluorophenyl)sulfanylpyrazine-2-carboxylate?
methyl 6-bromo-3-(4-fluorophenyl)sulfanylpyrazine-2-carboxylate has a molecular weight of 343.18 g/mol, XLogP of 3.32, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-bromo-3-(4-fluorophenyl)sulfanylpyrazine-2-carboxylate is sourced from PubChem (CID 86643719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).