C27H22ClFN4O2S — CID 86643797
5-[(1-chloro-9-fluorobenzo[h]isoquinolin-5-yl)amino]-2,4-dimethyl-N-(pyridin-3-ylmethyl)benzenesulfonamide (PubChem CID 86643797) has the molecular formula C27H22ClFN4O2S and a molecular weight of 521.02 g/mol. Its IUPAC name is 5-[(1-chloro-9-fluorobenzo[h]isoquinolin-5-yl)amino]-2,4-dimethyl-N-(pyridin-3-ylmethyl)benzenesulfonamide.
| Compound Name | 5-[(1-chloro-9-fluorobenzo[h]isoquinolin-5-yl)amino]-2,4-dimethyl-N-(pyridin-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 86643797 |
| Molecular Formula | C27H22ClFN4O2S |
| Molecular Weight | 521.02 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 5-[(1-chloro-9-fluorobenzo[h]isoquinolin-5-yl)amino]-2,4-dimethyl-N-(pyridin-3-ylmethyl)benzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCc2cccnc2)cc1Nc1cc2ccc(F)cc2c2c(Cl)nccc12 |
| InChI | InChI=1S/C27H22ClFN4O2S/c1-16-10-17(2)25(36(34,35)32-15-18-4-3-8-30-14-18)13-23(16)33-24-11-19-5-6-20(29)12-22(19)26-21(24)7-9-31-27(26)28/h3-14,32-33H,15H2,1-2H3 |
| InChIKey | BPLWYIHXZNUIDH-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.02 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|