About 4-nitro-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoic acid
4-nitro-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoic acid (PubChem CID 86643837) has the molecular formula C14H13F3N2O6
and a molecular weight of 362.26 g/mol. Its IUPAC name is 4-nitro-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoic acid.
Molecular Properties
| Compound Name | 4-nitro-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoic acid |
| PubChem CID | 86643837 |
| Molecular Formula | C14H13F3N2O6 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 4-nitro-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1N(C(=O)C(F)(F)F)C1CCOCC1 |
| InChI | InChI=1S/C14H13F3N2O6/c15-14(16,17)13(22)18(8-3-5-25-6-4-8)11-7-9(19(23)24)1-2-10(11)12(20)21/h1-2,7-8H,3-6H2,(H,20,21) |
| InChIKey | RLMJKSISKNIJRF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoic acid?
The IUPAC name of 4-nitro-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoic acid (CID 86643837) is 4-nitro-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoic acid.
What is the SMILES notation for 4-nitro-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoic acid?
The canonical SMILES for 4-nitro-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoic acid is O=C(O)c1ccc([N+](=O)[O-])cc1N(C(=O)C(F)(F)F)C1CCOCC1.
What is the InChIKey of 4-nitro-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoic acid?
The InChIKey is RLMJKSISKNIJRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F3N2O6/c15-14(16,17)13(22)18(8-3-5-25-6-4-8)11-7-9(19(23)24)1-2-10(11)12(20)21/h1-2,7-8H,3-6H2,(H,20,21).
What are the key properties of 4-nitro-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoic acid?
4-nitro-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoic acid has a molecular weight of 362.26 g/mol, XLogP of 2.37, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoic acid is sourced from PubChem (CID 86643837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).