About tert-butyl N-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamate
tert-butyl N-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamate (PubChem CID 86644087) has the molecular formula C13H19N3O5
and a molecular weight of 297.31 g/mol. Its IUPAC name is tert-butyl N-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamate |
| PubChem CID | 86644087 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | tert-butyl N-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H19N3O5/c1-13(2,3)21-12(20)15-14-9(17)5-4-8-16-10(18)6-7-11(16)19/h6-7H,4-5,8H2,1-3H3,(H,14,17)(H,15,20) |
| InChIKey | LOHHUODDTGKTIJ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamate?
The IUPAC name of tert-butyl N-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamate (CID 86644087) is tert-butyl N-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamate.
What is the SMILES notation for tert-butyl N-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamate?
The canonical SMILES for tert-butyl N-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamate is CC(C)(C)OC(=O)NNC(=O)CCCN1C(=O)C=CC1=O.
What is the InChIKey of tert-butyl N-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamate?
The InChIKey is LOHHUODDTGKTIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O5/c1-13(2,3)21-12(20)15-14-9(17)5-4-8-16-10(18)6-7-11(16)19/h6-7H,4-5,8H2,1-3H3,(H,14,17)(H,15,20).
What are the key properties of tert-butyl N-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamate?
tert-butyl N-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamate has a molecular weight of 297.31 g/mol, XLogP of 0.25, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]carbamate is sourced from PubChem (CID 86644087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).