C34H34F6O5S2 — CID 86644257
2-[2-(1-adamantyl)acetyl]oxy-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonate;triphenylsulfanium (PubChem CID 86644257) has the molecular formula C34H34F6O5S2 and a molecular weight of 700.76 g/mol. Its IUPAC name is 2-[2-(1-adamantyl)acetyl]oxy-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonate;triphenylsulfanium.
| Compound Name | 2-[2-(1-adamantyl)acetyl]oxy-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 86644257 |
| Molecular Formula | C34H34F6O5S2 |
| Molecular Weight | 700.76 g/mol |
| Exact Mass | 700.18 |
| IUPAC Name | 2-[2-(1-adamantyl)acetyl]oxy-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonate;triphenylsulfanium |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)OC(CS(=O)(=O)[O-])(C(F)(F)F)C(F)(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C16H20F6O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;17-15(18,19)14(16(20,21)22,8-28(24,25)26)27-12(23)7-13-4-9-1-10(5-13)3-11(2-9)6-13/h1-15H;9-11H,1-8H2,(H,24,25,26)/q+1;/p-1 |
| InChIKey | ZBLQGYXPYPHYGM-UHFFFAOYSA-M |
| XLogP | 8.33 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.76 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|