C15H9ClF10N2O2S — CID 86644454
5-chloro-1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-3-(1,1,2,3,3,3-hexafluoropropoxy)pyrazole (PubChem CID 86644454) has the molecular formula C15H9ClF10N2O2S and a molecular weight of 506.75 g/mol. Its IUPAC name is 5-chloro-1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-3-(1,1,2,3,3,3-hexafluoropropoxy)pyrazole.
| Compound Name | 5-chloro-1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-3-(1,1,2,3,3,3-hexafluoropropoxy)pyrazole |
|---|---|
| PubChem CID | 86644454 |
| Molecular Formula | C15H9ClF10N2O2S |
| Molecular Weight | 506.75 g/mol |
| Exact Mass | 505.99 |
| IUPAC Name | 5-chloro-1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-3-(1,1,2,3,3,3-hexafluoropropoxy)pyrazole |
| SMILES | Cc1cc(F)c(-n2nc(OC(F)(F)C(F)C(F)(F)F)cc2Cl)cc1S(=O)CC(F)(F)F |
| InChI | InChI=1S/C15H9ClF10N2O2S/c1-6-2-7(17)8(3-9(6)31(29)5-13(19,20)21)28-10(16)4-11(27-28)30-15(25,26)12(18)14(22,23)24/h2-4,12H,5H2,1H3 |
| InChIKey | QVKRMKUSBFJIDA-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.75 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |