C15H9ClF10N2OS — CID 86644455
5-chloro-1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(1,1,2,3,3,3-hexafluoropropoxy)pyrazole (PubChem CID 86644455) has the molecular formula C15H9ClF10N2OS and a molecular weight of 490.75 g/mol. Its IUPAC name is 5-chloro-1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(1,1,2,3,3,3-hexafluoropropoxy)pyrazole.
| Compound Name | 5-chloro-1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(1,1,2,3,3,3-hexafluoropropoxy)pyrazole |
|---|---|
| PubChem CID | 86644455 |
| Molecular Formula | C15H9ClF10N2OS |
| Molecular Weight | 490.75 g/mol |
| Exact Mass | 490.00 |
| IUPAC Name | 5-chloro-1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-3-(1,1,2,3,3,3-hexafluoropropoxy)pyrazole |
| SMILES | Cc1cc(F)c(-n2nc(OC(F)(F)C(F)C(F)(F)F)cc2Cl)cc1SCC(F)(F)F |
| InChI | InChI=1S/C15H9ClF10N2OS/c1-6-2-7(17)8(3-9(6)30-5-13(19,20)21)28-10(16)4-11(27-28)29-15(25,26)12(18)14(22,23)24/h2-4,12H,5H2,1H3 |
| InChIKey | BGRXNZCQALGVIE-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.75 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |