C16H13F9N2O3S — CID 86644479
[1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-3-(2,2,3,3,3-pentafluoropropoxy)pyrazol-5-yl]methanol (PubChem CID 86644479) has the molecular formula C16H13F9N2O3S and a molecular weight of 484.34 g/mol. Its IUPAC name is [1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-3-(2,2,3,3,3-pentafluoropropoxy)pyrazol-5-yl]methanol.
| Compound Name | [1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-3-(2,2,3,3,3-pentafluoropropoxy)pyrazol-5-yl]methanol |
|---|---|
| PubChem CID | 86644479 |
| Molecular Formula | C16H13F9N2O3S |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | [1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-3-(2,2,3,3,3-pentafluoropropoxy)pyrazol-5-yl]methanol |
| SMILES | Cc1cc(F)c(-n2nc(OCC(F)(F)C(F)(F)F)cc2CO)cc1S(=O)CC(F)(F)F |
| InChI | InChI=1S/C16H13F9N2O3S/c1-8-2-10(17)11(4-12(8)31(29)7-15(20,21)22)27-9(5-28)3-13(26-27)30-6-14(18,19)16(23,24)25/h2-4,28H,5-7H2,1H3 |
| InChIKey | WVWXRXVDLROISA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|