About 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-6H-benzo[d][1]benzazepin-7-one
5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-6H-benzo[d][1]benzazepin-7-one (PubChem CID 86644585) has the molecular formula C22H13F6NO3S
and a molecular weight of 485.41 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-6H-benzo[d][1]benzazepin-7-one.
Molecular Properties
| Compound Name | 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-6H-benzo[d][1]benzazepin-7-one |
| PubChem CID | 86644585 |
| Molecular Formula | C22H13F6NO3S |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-6H-benzo[d][1]benzazepin-7-one |
| SMILES | O=C1CN(S(=O)(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C22H13F6NO3S/c23-21(24,25)13-9-14(22(26,27)28)11-15(10-13)33(31,32)29-12-20(30)18-7-2-1-5-16(18)17-6-3-4-8-19(17)29/h1-11H,12H2 |
| InChIKey | XXMMTZUTEIIHGS-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-6H-benzo[d][1]benzazepin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-6H-benzo[d][1]benzazepin-7-one?
The IUPAC name of 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-6H-benzo[d][1]benzazepin-7-one (CID 86644585) is 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-6H-benzo[d][1]benzazepin-7-one.
What is the SMILES notation for 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-6H-benzo[d][1]benzazepin-7-one?
The canonical SMILES for 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-6H-benzo[d][1]benzazepin-7-one is O=C1CN(S(=O)(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccccc2-c2ccccc21.
What is the InChIKey of 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-6H-benzo[d][1]benzazepin-7-one?
The InChIKey is XXMMTZUTEIIHGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13F6NO3S/c23-21(24,25)13-9-14(22(26,27)28)11-15(10-13)33(31,32)29-12-20(30)18-7-2-1-5-16(18)17-6-3-4-8-19(17)29/h1-11H,12H2.
What are the key properties of 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-6H-benzo[d][1]benzazepin-7-one?
5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-6H-benzo[d][1]benzazepin-7-one has a molecular weight of 485.41 g/mol, XLogP of 5.78, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-6H-benzo[d][1]benzazepin-7-one is sourced from PubChem (CID 86644585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).