About (2S)-2-(4,4,4-trifluorobut-2-enylamino)butanamide
(2S)-2-(4,4,4-trifluorobut-2-enylamino)butanamide (PubChem CID 86644986) has the molecular formula C8H13F3N2O
and a molecular weight of 210.20 g/mol. Its IUPAC name is (2S)-2-(4,4,4-trifluorobut-2-enylamino)butanamide.
Molecular Properties
| Compound Name | (2S)-2-(4,4,4-trifluorobut-2-enylamino)butanamide |
| PubChem CID | 86644986 |
| Molecular Formula | C8H13F3N2O |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (2S)-2-(4,4,4-trifluorobut-2-enylamino)butanamide |
| SMILES | CC[C@H](NCC=CC(F)(F)F)C(N)=O |
| InChI | InChI=1S/C8H13F3N2O/c1-2-6(7(12)14)13-5-3-4-8(9,10)11/h3-4,6,13H,2,5H2,1H3,(H2,12,14)/t6-/m0/s1 |
| InChIKey | IPPYRUNDWGMZPC-LURJTMIESA-N |
| XLogP | 0.96 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-(4,4,4-trifluorobut-2-enylamino)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(4,4,4-trifluorobut-2-enylamino)butanamide?
The IUPAC name of (2S)-2-(4,4,4-trifluorobut-2-enylamino)butanamide (CID 86644986) is (2S)-2-(4,4,4-trifluorobut-2-enylamino)butanamide.
What is the SMILES notation for (2S)-2-(4,4,4-trifluorobut-2-enylamino)butanamide?
The canonical SMILES for (2S)-2-(4,4,4-trifluorobut-2-enylamino)butanamide is CC[C@H](NCC=CC(F)(F)F)C(N)=O.
What is the InChIKey of (2S)-2-(4,4,4-trifluorobut-2-enylamino)butanamide?
The InChIKey is IPPYRUNDWGMZPC-LURJTMIESA-N. The full InChI is InChI=1S/C8H13F3N2O/c1-2-6(7(12)14)13-5-3-4-8(9,10)11/h3-4,6,13H,2,5H2,1H3,(H2,12,14)/t6-/m0/s1.
What are the key properties of (2S)-2-(4,4,4-trifluorobut-2-enylamino)butanamide?
(2S)-2-(4,4,4-trifluorobut-2-enylamino)butanamide has a molecular weight of 210.20 g/mol, XLogP of 0.96, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(4,4,4-trifluorobut-2-enylamino)butanamide is sourced from PubChem (CID 86644986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).