About 5-aminopentane-1,2-diol;hydrochloride
5-aminopentane-1,2-diol;hydrochloride (PubChem CID 86645443) has the molecular formula C5H14ClNO2
and a molecular weight of 155.62 g/mol. Its IUPAC name is 5-aminopentane-1,2-diol;hydrochloride.
Molecular Properties
| Compound Name | 5-aminopentane-1,2-diol;hydrochloride |
| PubChem CID | 86645443 |
| Molecular Formula | C5H14ClNO2 |
| Molecular Weight | 155.62 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 5-aminopentane-1,2-diol;hydrochloride |
| SMILES | Cl.NCCCC(O)CO |
| InChI | InChI=1S/C5H13NO2.ClH/c6-3-1-2-5(8)4-7;/h5,7-8H,1-4,6H2;1H |
| InChIKey | XGLCCBGGPKKPIU-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.62 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-aminopentane-1,2-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminopentane-1,2-diol;hydrochloride?
The IUPAC name of 5-aminopentane-1,2-diol;hydrochloride (CID 86645443) is 5-aminopentane-1,2-diol;hydrochloride.
What is the SMILES notation for 5-aminopentane-1,2-diol;hydrochloride?
The canonical SMILES for 5-aminopentane-1,2-diol;hydrochloride is Cl.NCCCC(O)CO.
What is the InChIKey of 5-aminopentane-1,2-diol;hydrochloride?
The InChIKey is XGLCCBGGPKKPIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO2.ClH/c6-3-1-2-5(8)4-7;/h5,7-8H,1-4,6H2;1H.
What are the key properties of 5-aminopentane-1,2-diol;hydrochloride?
5-aminopentane-1,2-diol;hydrochloride has a molecular weight of 155.62 g/mol, XLogP of -0.50, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminopentane-1,2-diol;hydrochloride is sourced from PubChem (CID 86645443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).