C14H13N3O4 — CID 86645644
3-(4-benzoyl-6-methyl-3,5-dioxo-1,2,4-triazin-2-yl)propanal (PubChem CID 86645644) has the molecular formula C14H13N3O4 and a molecular weight of 287.27 g/mol. Its IUPAC name is 3-(4-benzoyl-6-methyl-3,5-dioxo-1,2,4-triazin-2-yl)propanal.
| Compound Name | 3-(4-benzoyl-6-methyl-3,5-dioxo-1,2,4-triazin-2-yl)propanal |
|---|---|
| PubChem CID | 86645644 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 3-(4-benzoyl-6-methyl-3,5-dioxo-1,2,4-triazin-2-yl)propanal |
| SMILES | Cc1nn(CCC=O)c(=O)n(C(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C14H13N3O4/c1-10-12(19)17(13(20)11-6-3-2-4-7-11)14(21)16(15-10)8-5-9-18/h2-4,6-7,9H,5,8H2,1H3 |
| InChIKey | QTBFQFNIVLXBIZ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 91.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|