C20H16ClF6NO6S — CID 86645883
[3-chloro-4-[4,4,4-trifluoro-3-hydroxy-3-(4-methyl-3-oxo-1,4-benzoxazin-7-yl)butan-2-yl]phenyl] trifluoromethanesulfonate (PubChem CID 86645883) has the molecular formula C20H16ClF6NO6S and a molecular weight of 547.86 g/mol. Its IUPAC name is [3-chloro-4-[4,4,4-trifluoro-3-hydroxy-3-(4-methyl-3-oxo-1,4-benzoxazin-7-yl)butan-2-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-chloro-4-[4,4,4-trifluoro-3-hydroxy-3-(4-methyl-3-oxo-1,4-benzoxazin-7-yl)butan-2-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86645883 |
| Molecular Formula | C20H16ClF6NO6S |
| Molecular Weight | 547.86 g/mol |
| Exact Mass | 547.03 |
| IUPAC Name | [3-chloro-4-[4,4,4-trifluoro-3-hydroxy-3-(4-methyl-3-oxo-1,4-benzoxazin-7-yl)butan-2-yl]phenyl] trifluoromethanesulfonate |
| SMILES | CC(c1ccc(OS(=O)(=O)C(F)(F)F)cc1Cl)C(O)(c1ccc2c(c1)OCC(=O)N2C)C(F)(F)F |
| InChI | InChI=1S/C20H16ClF6NO6S/c1-10(13-5-4-12(8-14(13)21)34-35(31,32)20(25,26)27)18(30,19(22,23)24)11-3-6-15-16(7-11)33-9-17(29)28(15)2/h3-8,10,30H,9H2,1-2H3 |
| InChIKey | ALVSWYGTEGYVIK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.86 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|