About 2-chloro-5-(2,2-diethoxyethoxy)pyrimidine
2-chloro-5-(2,2-diethoxyethoxy)pyrimidine (PubChem CID 86645897) has the molecular formula C10H15ClN2O3
and a molecular weight of 246.69 g/mol. Its IUPAC name is 2-chloro-5-(2,2-diethoxyethoxy)pyrimidine.
Molecular Properties
| Compound Name | 2-chloro-5-(2,2-diethoxyethoxy)pyrimidine |
| PubChem CID | 86645897 |
| Molecular Formula | C10H15ClN2O3 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2-chloro-5-(2,2-diethoxyethoxy)pyrimidine |
| SMILES | CCOC(COc1cnc(Cl)nc1)OCC |
| InChI | InChI=1S/C10H15ClN2O3/c1-3-14-9(15-4-2)7-16-8-5-12-10(11)13-6-8/h5-6,9H,3-4,7H2,1-2H3 |
| InChIKey | JYSFMTQGOYSAFH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-(2,2-diethoxyethoxy)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-(2,2-diethoxyethoxy)pyrimidine?
The IUPAC name of 2-chloro-5-(2,2-diethoxyethoxy)pyrimidine (CID 86645897) is 2-chloro-5-(2,2-diethoxyethoxy)pyrimidine.
What is the SMILES notation for 2-chloro-5-(2,2-diethoxyethoxy)pyrimidine?
The canonical SMILES for 2-chloro-5-(2,2-diethoxyethoxy)pyrimidine is CCOC(COc1cnc(Cl)nc1)OCC.
What is the InChIKey of 2-chloro-5-(2,2-diethoxyethoxy)pyrimidine?
The InChIKey is JYSFMTQGOYSAFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClN2O3/c1-3-14-9(15-4-2)7-16-8-5-12-10(11)13-6-8/h5-6,9H,3-4,7H2,1-2H3.
What are the key properties of 2-chloro-5-(2,2-diethoxyethoxy)pyrimidine?
2-chloro-5-(2,2-diethoxyethoxy)pyrimidine has a molecular weight of 246.69 g/mol, XLogP of 1.91, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(2,2-diethoxyethoxy)pyrimidine is sourced from PubChem (CID 86645897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).