C16H12ClFN4O2S — CID 86646044
N-[5-(5-amino-2-chloro-4-fluorophenoxy)-[1,3]thiazolo[5,4-b]pyridin-2-yl]cyclopropanecarboxamide (PubChem CID 86646044) has the molecular formula C16H12ClFN4O2S and a molecular weight of 378.82 g/mol. Its IUPAC name is N-[5-(5-amino-2-chloro-4-fluorophenoxy)-[1,3]thiazolo[5,4-b]pyridin-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[5-(5-amino-2-chloro-4-fluorophenoxy)-[1,3]thiazolo[5,4-b]pyridin-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 86646044 |
| Molecular Formula | C16H12ClFN4O2S |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | N-[5-(5-amino-2-chloro-4-fluorophenoxy)-[1,3]thiazolo[5,4-b]pyridin-2-yl]cyclopropanecarboxamide |
| SMILES | Nc1cc(Oc2ccc3nc(NC(=O)C4CC4)sc3n2)c(Cl)cc1F |
| InChI | InChI=1S/C16H12ClFN4O2S/c17-8-5-9(18)10(19)6-12(8)24-13-4-3-11-15(21-13)25-16(20-11)22-14(23)7-1-2-7/h3-7H,1-2,19H2,(H,20,22,23) |
| InChIKey | YFXQWRBCRCEWAC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|