C18H13ClN2O5 — CID 86646255
methyl 6-[[3-(4-chlorophenyl)-5-formyl-1,2-oxazol-4-yl]methoxy]pyridine-3-carboxylate (PubChem CID 86646255) has the molecular formula C18H13ClN2O5 and a molecular weight of 372.76 g/mol. Its IUPAC name is methyl 6-[[3-(4-chlorophenyl)-5-formyl-1,2-oxazol-4-yl]methoxy]pyridine-3-carboxylate.
| Compound Name | methyl 6-[[3-(4-chlorophenyl)-5-formyl-1,2-oxazol-4-yl]methoxy]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 86646255 |
| Molecular Formula | C18H13ClN2O5 |
| Molecular Weight | 372.76 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | methyl 6-[[3-(4-chlorophenyl)-5-formyl-1,2-oxazol-4-yl]methoxy]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(OCc2c(-c3ccc(Cl)cc3)noc2C=O)nc1 |
| InChI | InChI=1S/C18H13ClN2O5/c1-24-18(23)12-4-7-16(20-8-12)25-10-14-15(9-22)26-21-17(14)11-2-5-13(19)6-3-11/h2-9H,10H2,1H3 |
| InChIKey | XQMPIBXBYTZAOB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 91.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.76 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|