C19H17F2N3O2 — CID 86646511
2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3,4-difluoro-5-(2-pyrazin-2-ylethynyl)benzaldehyde (PubChem CID 86646511) has the molecular formula C19H17F2N3O2 and a molecular weight of 357.36 g/mol. Its IUPAC name is 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3,4-difluoro-5-(2-pyrazin-2-ylethynyl)benzaldehyde.
| Compound Name | 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3,4-difluoro-5-(2-pyrazin-2-ylethynyl)benzaldehyde |
|---|---|
| PubChem CID | 86646511 |
| Molecular Formula | C19H17F2N3O2 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-3,4-difluoro-5-(2-pyrazin-2-ylethynyl)benzaldehyde |
| SMILES | C[C@@H]1CN(c2c(C=O)cc(C#Cc3cnccn3)c(F)c2F)C[C@H](C)O1 |
| InChI | InChI=1S/C19H17F2N3O2/c1-12-9-24(10-13(2)26-12)19-15(11-25)7-14(17(20)18(19)21)3-4-16-8-22-5-6-23-16/h5-8,11-13H,9-10H2,1-2H3/t12-,13+ |
| InChIKey | QZJDLVUAZJYBJI-BETUJISGSA-N |
| XLogP | 2.58 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|