C8H5Cl2F3N2O2 — CID 86647335
3,5-dichloro-4-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide (PubChem CID 86647335) has the molecular formula C8H5Cl2F3N2O2 and a molecular weight of 289.04 g/mol. Its IUPAC name is 3,5-dichloro-4-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide.
| Compound Name | 3,5-dichloro-4-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 86647335 |
| Molecular Formula | C8H5Cl2F3N2O2 |
| Molecular Weight | 289.04 g/mol |
| Exact Mass | 287.97 |
| IUPAC Name | 3,5-dichloro-4-(2,2,2-trifluoroethoxy)pyridine-2-carboxamide |
| SMILES | NC(=O)c1ncc(Cl)c(OCC(F)(F)F)c1Cl |
| InChI | InChI=1S/C8H5Cl2F3N2O2/c9-3-1-15-5(7(14)16)4(10)6(3)17-2-8(11,12)13/h1H,2H2,(H2,14,16) |
| InChIKey | CNUAAYFMOZMAPA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.04 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |