About 2-amino-1,3-thiazole-5-carboxylic acid;hydrochloride
2-amino-1,3-thiazole-5-carboxylic acid;hydrochloride (PubChem CID 86648025) has the molecular formula C4H5ClN2O2S
and a molecular weight of 180.62 g/mol. Its IUPAC name is 2-amino-1,3-thiazole-5-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-1,3-thiazole-5-carboxylic acid;hydrochloride |
| PubChem CID | 86648025 |
| Molecular Formula | C4H5ClN2O2S |
| Molecular Weight | 180.62 g/mol |
| Exact Mass | 179.98 |
| IUPAC Name | 2-amino-1,3-thiazole-5-carboxylic acid;hydrochloride |
| SMILES | Cl.Nc1ncc(C(=O)O)s1 |
| InChI | InChI=1S/C4H4N2O2S.ClH/c5-4-6-1-2(9-4)3(7)8;/h1H,(H2,5,6)(H,7,8);1H |
| InChIKey | QLITWTWXJQNWLG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.62 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1,3-thiazole-5-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,3-thiazole-5-carboxylic acid;hydrochloride?
The IUPAC name of 2-amino-1,3-thiazole-5-carboxylic acid;hydrochloride (CID 86648025) is 2-amino-1,3-thiazole-5-carboxylic acid;hydrochloride.
What is the SMILES notation for 2-amino-1,3-thiazole-5-carboxylic acid;hydrochloride?
The canonical SMILES for 2-amino-1,3-thiazole-5-carboxylic acid;hydrochloride is Cl.Nc1ncc(C(=O)O)s1.
What is the InChIKey of 2-amino-1,3-thiazole-5-carboxylic acid;hydrochloride?
The InChIKey is QLITWTWXJQNWLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2S.ClH/c5-4-6-1-2(9-4)3(7)8;/h1H,(H2,5,6)(H,7,8);1H.
What are the key properties of 2-amino-1,3-thiazole-5-carboxylic acid;hydrochloride?
2-amino-1,3-thiazole-5-carboxylic acid;hydrochloride has a molecular weight of 180.62 g/mol, XLogP of 0.85, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,3-thiazole-5-carboxylic acid;hydrochloride is sourced from PubChem (CID 86648025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).