C21H19ClN4O2 — CID 86648174
3-(6-chloro-3-pyridinyl)-6-(4-ethoxy-3-methoxyphenyl)-2-methylimidazo[1,2-b]pyridazine (PubChem CID 86648174) has the molecular formula C21H19ClN4O2 and a molecular weight of 394.86 g/mol. Its IUPAC name is 3-(6-chloro-3-pyridinyl)-6-(4-ethoxy-3-methoxyphenyl)-2-methylimidazo[1,2-b]pyridazine.
| Compound Name | 3-(6-chloro-3-pyridinyl)-6-(4-ethoxy-3-methoxyphenyl)-2-methylimidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 86648174 |
| Molecular Formula | C21H19ClN4O2 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 3-(6-chloro-3-pyridinyl)-6-(4-ethoxy-3-methoxyphenyl)-2-methylimidazo[1,2-b]pyridazine |
| SMILES | CCOc1ccc(-c2ccc3nc(C)c(-c4ccc(Cl)nc4)n3n2)cc1OC |
| InChI | InChI=1S/C21H19ClN4O2/c1-4-28-17-8-5-14(11-18(17)27-3)16-7-10-20-24-13(2)21(26(20)25-16)15-6-9-19(22)23-12-15/h5-12H,4H2,1-3H3 |
| InChIKey | JIBPMAJYFDIDIY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|