About 10-methyl-5,5-dioxophenothiazine-3-carbaldehyde
10-methyl-5,5-dioxophenothiazine-3-carbaldehyde (PubChem CID 86648277) has the molecular formula C14H11NO3S
and a molecular weight of 273.31 g/mol. Its IUPAC name is 10-methyl-5,5-dioxophenothiazine-3-carbaldehyde.
Molecular Properties
| Compound Name | 10-methyl-5,5-dioxophenothiazine-3-carbaldehyde |
| PubChem CID | 86648277 |
| Molecular Formula | C14H11NO3S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 10-methyl-5,5-dioxophenothiazine-3-carbaldehyde |
| SMILES | CN1c2ccccc2S(=O)(=O)c2cc(C=O)ccc21 |
| InChI | InChI=1S/C14H11NO3S/c1-15-11-4-2-3-5-13(11)19(17,18)14-8-10(9-16)6-7-12(14)15/h2-9H,1H3 |
| InChIKey | ZBSYAONMNOLNLD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 10-methyl-5,5-dioxophenothiazine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyl-5,5-dioxophenothiazine-3-carbaldehyde?
The IUPAC name of 10-methyl-5,5-dioxophenothiazine-3-carbaldehyde (CID 86648277) is 10-methyl-5,5-dioxophenothiazine-3-carbaldehyde.
What is the SMILES notation for 10-methyl-5,5-dioxophenothiazine-3-carbaldehyde?
The canonical SMILES for 10-methyl-5,5-dioxophenothiazine-3-carbaldehyde is CN1c2ccccc2S(=O)(=O)c2cc(C=O)ccc21.
What is the InChIKey of 10-methyl-5,5-dioxophenothiazine-3-carbaldehyde?
The InChIKey is ZBSYAONMNOLNLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO3S/c1-15-11-4-2-3-5-13(11)19(17,18)14-8-10(9-16)6-7-12(14)15/h2-9H,1H3.
What are the key properties of 10-methyl-5,5-dioxophenothiazine-3-carbaldehyde?
10-methyl-5,5-dioxophenothiazine-3-carbaldehyde has a molecular weight of 273.31 g/mol, XLogP of 2.41, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyl-5,5-dioxophenothiazine-3-carbaldehyde is sourced from PubChem (CID 86648277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).