About tert-butyl (3R,4S)-4-amino-3-(2,2-difluoropropoxy)piperidine-1-carboxylate
tert-butyl (3R,4S)-4-amino-3-(2,2-difluoropropoxy)piperidine-1-carboxylate (PubChem CID 86648656) has the molecular formula C13H24F2N2O3
and a molecular weight of 294.34 g/mol. Its IUPAC name is tert-butyl (3R,4S)-4-amino-3-(2,2-difluoropropoxy)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (3R,4S)-4-amino-3-(2,2-difluoropropoxy)piperidine-1-carboxylate |
| PubChem CID | 86648656 |
| Molecular Formula | C13H24F2N2O3 |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | tert-butyl (3R,4S)-4-amino-3-(2,2-difluoropropoxy)piperidine-1-carboxylate |
| SMILES | CC(F)(F)CO[C@@H]1CN(C(=O)OC(C)(C)C)CC[C@@H]1N |
| InChI | InChI=1S/C13H24F2N2O3/c1-12(2,3)20-11(18)17-6-5-9(16)10(7-17)19-8-13(4,14)15/h9-10H,5-8,16H2,1-4H3/t9-,10+/m0/s1 |
| InChIKey | VRENZNHWFUWUPP-VHSXEESVSA-N |
| XLogP | 1.99 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (3R,4S)-4-amino-3-(2,2-difluoropropoxy)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3R,4S)-4-amino-3-(2,2-difluoropropoxy)piperidine-1-carboxylate?
The IUPAC name of tert-butyl (3R,4S)-4-amino-3-(2,2-difluoropropoxy)piperidine-1-carboxylate (CID 86648656) is tert-butyl (3R,4S)-4-amino-3-(2,2-difluoropropoxy)piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl (3R,4S)-4-amino-3-(2,2-difluoropropoxy)piperidine-1-carboxylate?
The canonical SMILES for tert-butyl (3R,4S)-4-amino-3-(2,2-difluoropropoxy)piperidine-1-carboxylate is CC(F)(F)CO[C@@H]1CN(C(=O)OC(C)(C)C)CC[C@@H]1N.
What is the InChIKey of tert-butyl (3R,4S)-4-amino-3-(2,2-difluoropropoxy)piperidine-1-carboxylate?
The InChIKey is VRENZNHWFUWUPP-VHSXEESVSA-N. The full InChI is InChI=1S/C13H24F2N2O3/c1-12(2,3)20-11(18)17-6-5-9(16)10(7-17)19-8-13(4,14)15/h9-10H,5-8,16H2,1-4H3/t9-,10+/m0/s1.
What are the key properties of tert-butyl (3R,4S)-4-amino-3-(2,2-difluoropropoxy)piperidine-1-carboxylate?
tert-butyl (3R,4S)-4-amino-3-(2,2-difluoropropoxy)piperidine-1-carboxylate has a molecular weight of 294.34 g/mol, XLogP of 1.99, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3R,4S)-4-amino-3-(2,2-difluoropropoxy)piperidine-1-carboxylate is sourced from PubChem (CID 86648656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).