C16H23ClN4O5 — CID 86648668
methyl 2-[(3R,4S)-4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]-3-ethoxypiperidin-1-yl]-2-oxoacetate (PubChem CID 86648668) has the molecular formula C16H23ClN4O5 and a molecular weight of 386.84 g/mol. Its IUPAC name is methyl 2-[(3R,4S)-4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]-3-ethoxypiperidin-1-yl]-2-oxoacetate.
| Compound Name | methyl 2-[(3R,4S)-4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]-3-ethoxypiperidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 86648668 |
| Molecular Formula | C16H23ClN4O5 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | methyl 2-[(3R,4S)-4-[(4-chloro-5-ethyl-1H-imidazole-2-carbonyl)amino]-3-ethoxypiperidin-1-yl]-2-oxoacetate |
| SMILES | CCO[C@@H]1CN(C(=O)C(=O)OC)CC[C@@H]1NC(=O)c1nc(Cl)c(CC)[nH]1 |
| InChI | InChI=1S/C16H23ClN4O5/c1-4-9-12(17)20-13(18-9)14(22)19-10-6-7-21(8-11(10)26-5-2)15(23)16(24)25-3/h10-11H,4-8H2,1-3H3,(H,18,20)(H,19,22)/t10-,11+/m0/s1 |
| InChIKey | WEXMGWZRCYKOAM-WDEREUQCSA-N |
| XLogP | 0.53 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|