C21H28F2N2O8 — CID 86648925
(2S,3R,4S,5S,6R)-2-[4-[(2,3-difluoro-4-methoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 86648925) has the molecular formula C21H28F2N2O8 and a molecular weight of 474.46 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[4-[(2,3-difluoro-4-methoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[4-[(2,3-difluoro-4-methoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 86648925 |
| Molecular Formula | C21H28F2N2O8 |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[4-[(2,3-difluoro-4-methoxyphenyl)methyl]-5-methyl-1-propan-2-ylpyrazol-3-yl]oxy-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | COc1ccc(Cc2c(O[C@@]3(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)nn(C(C)C)c2C)c(F)c1F |
| InChI | InChI=1S/C21H28F2N2O8/c1-9(2)25-10(3)12(7-11-5-6-13(31-4)16(23)15(11)22)20(24-25)33-21(30)19(29)18(28)17(27)14(8-26)32-21/h5-6,9,14,17-19,26-30H,7-8H2,1-4H3/t14-,17-,18+,19-,21+/m1/s1 |
| InChIKey | YDZPXLPSWNLHKT-VPRICQMDSA-N |
| XLogP | 0.15 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|