C9H5FO4 — CID 86649050
5-(4-fluorophenyl)-1,3-dioxolane-2,4-dione (PubChem CID 86649050) has the molecular formula C9H5FO4 and a molecular weight of 196.13 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-1,3-dioxolane-2,4-dione.
| Compound Name | 5-(4-fluorophenyl)-1,3-dioxolane-2,4-dione |
|---|---|
| PubChem CID | 86649050 |
| Molecular Formula | C9H5FO4 |
| Molecular Weight | 196.13 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 5-(4-fluorophenyl)-1,3-dioxolane-2,4-dione |
| SMILES | O=C1OC(=O)C(c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C9H5FO4/c10-6-3-1-5(2-4-6)7-8(11)14-9(12)13-7/h1-4,7H |
| InChIKey | XIHJGRAREIFIPR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.13 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|