C7H9F9N2O2S — CID 86649493
N-(2-aminoethyl)-1,1,2,2,3,3,4,4,4-nonafluoro-N-methylbutane-1-sulfonamide (PubChem CID 86649493) has the molecular formula C7H9F9N2O2S and a molecular weight of 356.21 g/mol. Its IUPAC name is N-(2-aminoethyl)-1,1,2,2,3,3,4,4,4-nonafluoro-N-methylbutane-1-sulfonamide.
| Compound Name | N-(2-aminoethyl)-1,1,2,2,3,3,4,4,4-nonafluoro-N-methylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 86649493 |
| Molecular Formula | C7H9F9N2O2S |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | N-(2-aminoethyl)-1,1,2,2,3,3,4,4,4-nonafluoro-N-methylbutane-1-sulfonamide |
| SMILES | CN(CCN)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H9F9N2O2S/c1-18(3-2-17)21(19,20)7(15,16)5(10,11)4(8,9)6(12,13)14/h2-3,17H2,1H3 |
| InChIKey | AITGNBIDZSPQEO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|