C13H18N2O3S2 — CID 86649592
2-methyl-1,3-thiazol-3-ium-3-amine;2,4,6-trimethylbenzenesulfonate (PubChem CID 86649592) has the molecular formula C13H18N2O3S2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 2-methyl-1,3-thiazol-3-ium-3-amine;2,4,6-trimethylbenzenesulfonate.
| Compound Name | 2-methyl-1,3-thiazol-3-ium-3-amine;2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 86649592 |
| Molecular Formula | C13H18N2O3S2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-methyl-1,3-thiazol-3-ium-3-amine;2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)[O-])c(C)c1.Cc1scc[n+]1N |
| InChI | InChI=1S/C9H12O3S.C4H7N2S/c1-6-4-7(2)9(8(3)5-6)13(10,11)12;1-4-6(5)2-3-7-4/h4-5H,1-3H3,(H,10,11,12);2-3H,5H2,1H3/q;+1/p-1 |
| InChIKey | VNSOMIBQEQNELU-UHFFFAOYSA-M |
| XLogP | 1.57 |
| TPSA | 87.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|