About N-(2-aminoethyl)-1,1,1-trifluoromethanesulfonamide;hydrochloride
N-(2-aminoethyl)-1,1,1-trifluoromethanesulfonamide;hydrochloride (PubChem CID 86649952) has the molecular formula C3H8ClF3N2O2S
and a molecular weight of 228.62 g/mol. Its IUPAC name is N-(2-aminoethyl)-1,1,1-trifluoromethanesulfonamide;hydrochloride.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-1,1,1-trifluoromethanesulfonamide;hydrochloride |
| PubChem CID | 86649952 |
| Molecular Formula | C3H8ClF3N2O2S |
| Molecular Weight | 228.62 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | N-(2-aminoethyl)-1,1,1-trifluoromethanesulfonamide;hydrochloride |
| SMILES | Cl.NCCNS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C3H7F3N2O2S.ClH/c4-3(5,6)11(9,10)8-2-1-7;/h8H,1-2,7H2;1H |
| InChIKey | MSEXLKBTOZNUON-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.62 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-aminoethyl)-1,1,1-trifluoromethanesulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-1,1,1-trifluoromethanesulfonamide;hydrochloride?
The IUPAC name of N-(2-aminoethyl)-1,1,1-trifluoromethanesulfonamide;hydrochloride (CID 86649952) is N-(2-aminoethyl)-1,1,1-trifluoromethanesulfonamide;hydrochloride.
What is the SMILES notation for N-(2-aminoethyl)-1,1,1-trifluoromethanesulfonamide;hydrochloride?
The canonical SMILES for N-(2-aminoethyl)-1,1,1-trifluoromethanesulfonamide;hydrochloride is Cl.NCCNS(=O)(=O)C(F)(F)F.
What is the InChIKey of N-(2-aminoethyl)-1,1,1-trifluoromethanesulfonamide;hydrochloride?
The InChIKey is MSEXLKBTOZNUON-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7F3N2O2S.ClH/c4-3(5,6)11(9,10)8-2-1-7;/h8H,1-2,7H2;1H.
What are the key properties of N-(2-aminoethyl)-1,1,1-trifluoromethanesulfonamide;hydrochloride?
N-(2-aminoethyl)-1,1,1-trifluoromethanesulfonamide;hydrochloride has a molecular weight of 228.62 g/mol, XLogP of -0.19, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-1,1,1-trifluoromethanesulfonamide;hydrochloride is sourced from PubChem (CID 86649952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).