C26H31N3O4 — CID 86650174
(3aS,9bR)-2-[2-[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]cyclohexyl]ethyl]-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrole-8-carbonitrile (PubChem CID 86650174) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is (3aS,9bR)-2-[2-[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]cyclohexyl]ethyl]-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrole-8-carbonitrile.
| Compound Name | (3aS,9bR)-2-[2-[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]cyclohexyl]ethyl]-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrole-8-carbonitrile |
|---|---|
| PubChem CID | 86650174 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | (3aS,9bR)-2-[2-[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]cyclohexyl]ethyl]-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrole-8-carbonitrile |
| SMILES | CCOc1c(NC2CCC(CCN3C[C@H]4COc5ccc(C#N)cc5[C@@H]4C3)CC2)c(=O)c1=O |
| InChI | InChI=1S/C26H31N3O4/c1-2-32-26-23(24(30)25(26)31)28-19-6-3-16(4-7-19)9-10-29-13-18-15-33-22-8-5-17(12-27)11-20(22)21(18)14-29/h5,8,11,16,18-19,21,28H,2-4,6-7,9-10,13-15H2,1H3/t16?,18-,19?,21+/m0/s1 |
| InChIKey | PUEOYEZYNRQTOE-BVPCWRRESA-N |
| XLogP | 3.02 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|