About [4-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methyl methanesulfonate
[4-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methyl methanesulfonate (PubChem CID 86650891) has the molecular formula C9H13NO5S2
and a molecular weight of 279.34 g/mol. Its IUPAC name is [4-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methyl methanesulfonate.
Molecular Properties
| Compound Name | [4-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methyl methanesulfonate |
| PubChem CID | 86650891 |
| Molecular Formula | C9H13NO5S2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | [4-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methyl methanesulfonate |
| SMILES | CC1(c2csc(COS(C)(=O)=O)n2)OCCO1 |
| InChI | InChI=1S/C9H13NO5S2/c1-9(13-3-4-14-9)7-6-16-8(10-7)5-15-17(2,11)12/h6H,3-5H2,1-2H3 |
| InChIKey | IIJQFMPYXVLAPU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methyl methanesulfonate?
The IUPAC name of [4-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methyl methanesulfonate (CID 86650891) is [4-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methyl methanesulfonate.
What is the SMILES notation for [4-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methyl methanesulfonate?
The canonical SMILES for [4-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methyl methanesulfonate is CC1(c2csc(COS(C)(=O)=O)n2)OCCO1.
What is the InChIKey of [4-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methyl methanesulfonate?
The InChIKey is IIJQFMPYXVLAPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO5S2/c1-9(13-3-4-14-9)7-6-16-8(10-7)5-15-17(2,11)12/h6H,3-5H2,1-2H3.
What are the key properties of [4-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methyl methanesulfonate?
[4-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methyl methanesulfonate has a molecular weight of 279.34 g/mol, XLogP of 0.84, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-methyl-1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methyl methanesulfonate is sourced from PubChem (CID 86650891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).