About 3-hydroxy-1,1-bis(trifluoromethanesulfonyl)butane sodium salt
3-hydroxy-1,1-bis(trifluoromethanesulfonyl)butane sodium salt (PubChem CID 86652133) has the molecular formula C6H8F6NaO5S2
and a molecular weight of 361.24 g/mol.
Molecular Properties
| Compound Name | 3-hydroxy-1,1-bis(trifluoromethanesulfonyl)butane sodium salt |
| PubChem CID | 86652133 |
| Molecular Formula | C6H8F6NaO5S2 |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | — |
| SMILES | CC(O)CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F.[Na] |
| InChI | InChI=1S/C6H8F6O5S2.Na/c1-3(13)2-4(18(14,15)5(7,8)9)19(16,17)6(10,11)12;/h3-4,13H,2H2,1H3; |
| InChIKey | ANWFFYYQZFYEMG-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-hydroxy-1,1-bis(trifluoromethanesulfonyl)butane sodium salt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-1,1-bis(trifluoromethanesulfonyl)butane sodium salt?
The IUPAC name of 3-hydroxy-1,1-bis(trifluoromethanesulfonyl)butane sodium salt (CID 86652133) is not available.
What is the SMILES notation for 3-hydroxy-1,1-bis(trifluoromethanesulfonyl)butane sodium salt?
The canonical SMILES for 3-hydroxy-1,1-bis(trifluoromethanesulfonyl)butane sodium salt is CC(O)CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F.[Na].
What is the InChIKey of 3-hydroxy-1,1-bis(trifluoromethanesulfonyl)butane sodium salt?
The InChIKey is ANWFFYYQZFYEMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F6O5S2.Na/c1-3(13)2-4(18(14,15)5(7,8)9)19(16,17)6(10,11)12;/h3-4,13H,2H2,1H3;.
What are the key properties of 3-hydroxy-1,1-bis(trifluoromethanesulfonyl)butane sodium salt?
3-hydroxy-1,1-bis(trifluoromethanesulfonyl)butane sodium salt has a molecular weight of 361.24 g/mol, XLogP of 0.57, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-1,1-bis(trifluoromethanesulfonyl)butane sodium salt is sourced from PubChem (CID 86652133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).