About 4,4-bis(trifluoromethylsulfonyl)butan-2-yl benzoate;triphenylsulfanium
4,4-bis(trifluoromethylsulfonyl)butan-2-yl benzoate;triphenylsulfanium (PubChem CID 86652134) has the molecular formula C31H27F6O6S3+
and a molecular weight of 705.74 g/mol. Its IUPAC name is 4,4-bis(trifluoromethylsulfonyl)butan-2-yl benzoate;triphenylsulfanium.
Molecular Properties
| Compound Name | 4,4-bis(trifluoromethylsulfonyl)butan-2-yl benzoate;triphenylsulfanium |
| PubChem CID | 86652134 |
| Molecular Formula | C31H27F6O6S3+ |
| Molecular Weight | 705.74 g/mol |
| Exact Mass | 705.09 |
| IUPAC Name | 4,4-bis(trifluoromethylsulfonyl)butan-2-yl benzoate;triphenylsulfanium |
| SMILES | CC(CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)OC(=O)c1ccccc1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C13H12F6O6S2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-8(25-11(20)9-5-3-2-4-6-9)7-10(26(21,22)12(14,15)16)27(23,24)13(17,18)19/h1-15H;2-6,8,10H,7H2,1H3/q+1; |
| InChIKey | VETQSWHXJQCUNN-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 705.74 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 4,4-bis(trifluoromethylsulfonyl)butan-2-yl benzoate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-bis(trifluoromethylsulfonyl)butan-2-yl benzoate;triphenylsulfanium?
The IUPAC name of 4,4-bis(trifluoromethylsulfonyl)butan-2-yl benzoate;triphenylsulfanium (CID 86652134) is 4,4-bis(trifluoromethylsulfonyl)butan-2-yl benzoate;triphenylsulfanium.
What is the SMILES notation for 4,4-bis(trifluoromethylsulfonyl)butan-2-yl benzoate;triphenylsulfanium?
The canonical SMILES for 4,4-bis(trifluoromethylsulfonyl)butan-2-yl benzoate;triphenylsulfanium is CC(CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)OC(=O)c1ccccc1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 4,4-bis(trifluoromethylsulfonyl)butan-2-yl benzoate;triphenylsulfanium?
The InChIKey is VETQSWHXJQCUNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15S.C13H12F6O6S2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-8(25-11(20)9-5-3-2-4-6-9)7-10(26(21,22)12(14,15)16)27(23,24)13(17,18)19/h1-15H;2-6,8,10H,7H2,1H3/q+1;.
What are the key properties of 4,4-bis(trifluoromethylsulfonyl)butan-2-yl benzoate;triphenylsulfanium?
4,4-bis(trifluoromethylsulfonyl)butan-2-yl benzoate;triphenylsulfanium has a molecular weight of 705.74 g/mol, XLogP of 7.60, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-bis(trifluoromethylsulfonyl)butan-2-yl benzoate;triphenylsulfanium is sourced from PubChem (CID 86652134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).