About 5-(benzenesulfonyl)-1,3-thiazole-4-carbaldehyde
5-(benzenesulfonyl)-1,3-thiazole-4-carbaldehyde (PubChem CID 86652201) has the molecular formula C10H7NO3S2
and a molecular weight of 253.30 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-1,3-thiazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 5-(benzenesulfonyl)-1,3-thiazole-4-carbaldehyde |
| PubChem CID | 86652201 |
| Molecular Formula | C10H7NO3S2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 252.99 |
| IUPAC Name | 5-(benzenesulfonyl)-1,3-thiazole-4-carbaldehyde |
| SMILES | O=Cc1ncsc1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C10H7NO3S2/c12-6-9-10(15-7-11-9)16(13,14)8-4-2-1-3-5-8/h1-7H |
| InChIKey | RUENBDWOKGPWJZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-(benzenesulfonyl)-1,3-thiazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(benzenesulfonyl)-1,3-thiazole-4-carbaldehyde?
The IUPAC name of 5-(benzenesulfonyl)-1,3-thiazole-4-carbaldehyde (CID 86652201) is 5-(benzenesulfonyl)-1,3-thiazole-4-carbaldehyde.
What is the SMILES notation for 5-(benzenesulfonyl)-1,3-thiazole-4-carbaldehyde?
The canonical SMILES for 5-(benzenesulfonyl)-1,3-thiazole-4-carbaldehyde is O=Cc1ncsc1S(=O)(=O)c1ccccc1.
What is the InChIKey of 5-(benzenesulfonyl)-1,3-thiazole-4-carbaldehyde?
The InChIKey is RUENBDWOKGPWJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO3S2/c12-6-9-10(15-7-11-9)16(13,14)8-4-2-1-3-5-8/h1-7H.
What are the key properties of 5-(benzenesulfonyl)-1,3-thiazole-4-carbaldehyde?
5-(benzenesulfonyl)-1,3-thiazole-4-carbaldehyde has a molecular weight of 253.30 g/mol, XLogP of 1.79, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(benzenesulfonyl)-1,3-thiazole-4-carbaldehyde is sourced from PubChem (CID 86652201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).