C26H25Cl2FN4O4 — CID 86652663
4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-N-tert-butyl-2-fluoroaniline (PubChem CID 86652663) has the molecular formula C26H25Cl2FN4O4 and a molecular weight of 547.41 g/mol. Its IUPAC name is 4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-N-tert-butyl-2-fluoroaniline.
| Compound Name | 4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-N-tert-butyl-2-fluoroaniline |
|---|---|
| PubChem CID | 86652663 |
| Molecular Formula | C26H25Cl2FN4O4 |
| Molecular Weight | 547.41 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | 4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-N-tert-butyl-2-fluoroaniline |
| SMILES | CC(C)(C)Nc1ccc(N2[C@@H](c3ccc(Cl)c([N+](=O)[O-])c3)CC[C@@H]2c2ccc(Cl)c([N+](=O)[O-])c2)cc1F |
| InChI | InChI=1S/C26H25Cl2FN4O4/c1-26(2,3)30-21-9-6-17(14-20(21)29)31-22(15-4-7-18(27)24(12-15)32(34)35)10-11-23(31)16-5-8-19(28)25(13-16)33(36)37/h4-9,12-14,22-23,30H,10-11H2,1-3H3/t22-,23-/m1/s1 |
| InChIKey | ALTLGPVPDQFBOP-DHIUTWEWSA-N |
| XLogP | 8.24 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.41 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|