C13H13F6NO2 — CID 86652692
ethyl 2-[3,4-bis(trifluoromethyl)anilino]propanoate (PubChem CID 86652692) has the molecular formula C13H13F6NO2 and a molecular weight of 329.24 g/mol. Its IUPAC name is ethyl 2-[3,4-bis(trifluoromethyl)anilino]propanoate.
| Compound Name | ethyl 2-[3,4-bis(trifluoromethyl)anilino]propanoate |
|---|---|
| PubChem CID | 86652692 |
| Molecular Formula | C13H13F6NO2 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | ethyl 2-[3,4-bis(trifluoromethyl)anilino]propanoate |
| SMILES | CCOC(=O)C(C)Nc1ccc(C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F6NO2/c1-3-22-11(21)7(2)20-8-4-5-9(12(14,15)16)10(6-8)13(17,18)19/h4-7,20H,3H2,1-2H3 |
| InChIKey | DSGHRJRRFDDJBW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |