C21H21F6N5O — CID 86653504
2,3-dimethyl-5-(trifluoromethyl)-N-[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]ethyl]imidazo[1,2-a]pyridine-8-carboxamide (PubChem CID 86653504) has the molecular formula C21H21F6N5O and a molecular weight of 473.42 g/mol. Its IUPAC name is 2,3-dimethyl-5-(trifluoromethyl)-N-[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]ethyl]imidazo[1,2-a]pyridine-8-carboxamide.
| Compound Name | 2,3-dimethyl-5-(trifluoromethyl)-N-[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]ethyl]imidazo[1,2-a]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 86653504 |
| Molecular Formula | C21H21F6N5O |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 2,3-dimethyl-5-(trifluoromethyl)-N-[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]ethyl]imidazo[1,2-a]pyridine-8-carboxamide |
| SMILES | Cc1nc2c(C(=O)NCCn3nc(C(F)(F)F)c4c3CCCC4)ccc(C(F)(F)F)n2c1C |
| InChI | InChI=1S/C21H21F6N5O/c1-11-12(2)32-16(20(22,23)24)8-7-14(18(32)29-11)19(33)28-9-10-31-15-6-4-3-5-13(15)17(30-31)21(25,26)27/h7-8H,3-6,9-10H2,1-2H3,(H,28,33) |
| InChIKey | HXKKDJYGVDRLCQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |