C9H8F6N2S — CID 86653733
2-(trifluoromethyl)-5-(3,3,3-trifluoropropylsulfanylmethyl)pyrimidine (PubChem CID 86653733) has the molecular formula C9H8F6N2S and a molecular weight of 290.23 g/mol. Its IUPAC name is 2-(trifluoromethyl)-5-(3,3,3-trifluoropropylsulfanylmethyl)pyrimidine.
| Compound Name | 2-(trifluoromethyl)-5-(3,3,3-trifluoropropylsulfanylmethyl)pyrimidine |
|---|---|
| PubChem CID | 86653733 |
| Molecular Formula | C9H8F6N2S |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 2-(trifluoromethyl)-5-(3,3,3-trifluoropropylsulfanylmethyl)pyrimidine |
| SMILES | FC(F)(F)CCSCc1cnc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C9H8F6N2S/c10-8(11,12)1-2-18-5-6-3-16-7(17-4-6)9(13,14)15/h3-4H,1-2,5H2 |
| InChIKey | FLRWYURSUAUATJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|