C30H37NO3 — CID 86653783
N-propyl-4-[2,4,5-trimethyl-3,6-bis(phenylmethoxy)phenyl]butanamide (PubChem CID 86653783) has the molecular formula C30H37NO3 and a molecular weight of 459.63 g/mol. Its IUPAC name is N-propyl-4-[2,4,5-trimethyl-3,6-bis(phenylmethoxy)phenyl]butanamide.
| Compound Name | N-propyl-4-[2,4,5-trimethyl-3,6-bis(phenylmethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 86653783 |
| Molecular Formula | C30H37NO3 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | N-propyl-4-[2,4,5-trimethyl-3,6-bis(phenylmethoxy)phenyl]butanamide |
| SMILES | CCCNC(=O)CCCc1c(C)c(OCc2ccccc2)c(C)c(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C30H37NO3/c1-5-19-31-28(32)18-12-17-27-24(4)29(33-20-25-13-8-6-9-14-25)22(2)23(3)30(27)34-21-26-15-10-7-11-16-26/h6-11,13-16H,5,12,17-21H2,1-4H3,(H,31,32) |
| InChIKey | PUKYGROKOJAXIV-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |