C27H23ClF4N2O2Si — CID 86653966
[3-[3-chloro-5-(3,5-dimethoxyphenyl)-6-(2-fluorophenyl)pyridazin-4-yl]-2,4,6-trifluorophenyl]-trimethylsilane (PubChem CID 86653966) has the molecular formula C27H23ClF4N2O2Si and a molecular weight of 547.02 g/mol. Its IUPAC name is [3-[3-chloro-5-(3,5-dimethoxyphenyl)-6-(2-fluorophenyl)pyridazin-4-yl]-2,4,6-trifluorophenyl]-trimethylsilane.
| Compound Name | [3-[3-chloro-5-(3,5-dimethoxyphenyl)-6-(2-fluorophenyl)pyridazin-4-yl]-2,4,6-trifluorophenyl]-trimethylsilane |
|---|---|
| PubChem CID | 86653966 |
| Molecular Formula | C27H23ClF4N2O2Si |
| Molecular Weight | 547.02 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | [3-[3-chloro-5-(3,5-dimethoxyphenyl)-6-(2-fluorophenyl)pyridazin-4-yl]-2,4,6-trifluorophenyl]-trimethylsilane |
| SMILES | COc1cc(OC)cc(-c2c(-c3ccccc3F)nnc(Cl)c2-c2c(F)cc(F)c([Si](C)(C)C)c2F)c1 |
| InChI | InChI=1S/C27H23ClF4N2O2Si/c1-35-15-10-14(11-16(12-15)36-2)21-23(22-19(30)13-20(31)26(24(22)32)37(3,4)5)27(28)34-33-25(21)17-8-6-7-9-18(17)29/h6-13H,1-5H3 |
| InChIKey | FNZURKUIXWMFSK-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.02 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|