C20H19Cl2NO2 — CID 86654134
[(4aS,10bR)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3,5-dichloro-4-hydroxyphenyl)methanone (PubChem CID 86654134) has the molecular formula C20H19Cl2NO2 and a molecular weight of 376.28 g/mol. Its IUPAC name is [(4aS,10bR)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3,5-dichloro-4-hydroxyphenyl)methanone.
| Compound Name | [(4aS,10bR)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3,5-dichloro-4-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 86654134 |
| Molecular Formula | C20H19Cl2NO2 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | [(4aS,10bR)-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-4-yl]-(3,5-dichloro-4-hydroxyphenyl)methanone |
| SMILES | O=C(c1cc(Cl)c(O)c(Cl)c1)N1CCC[C@@H]2c3ccccc3CC[C@@H]21 |
| InChI | InChI=1S/C20H19Cl2NO2/c21-16-10-13(11-17(22)19(16)24)20(25)23-9-3-6-15-14-5-2-1-4-12(14)7-8-18(15)23/h1-2,4-5,10-11,15,18,24H,3,6-9H2/t15-,18+/m1/s1 |
| InChIKey | PJDILBAYBUSUDB-QAPCUYQASA-N |
| XLogP | 5.03 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |