C12H23NO6SSi — CID 86654377
methanesulfonate;trimethoxy-[2-(1-methylpyridin-1-ium-2-yl)ethyl]silane (PubChem CID 86654377) has the molecular formula C12H23NO6SSi and a molecular weight of 337.47 g/mol. Its IUPAC name is methanesulfonate;trimethoxy-[2-(1-methylpyridin-1-ium-2-yl)ethyl]silane.
| Compound Name | methanesulfonate;trimethoxy-[2-(1-methylpyridin-1-ium-2-yl)ethyl]silane |
|---|---|
| PubChem CID | 86654377 |
| Molecular Formula | C12H23NO6SSi |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | methanesulfonate;trimethoxy-[2-(1-methylpyridin-1-ium-2-yl)ethyl]silane |
| SMILES | CO[Si](CCc1cccc[n+]1C)(OC)OC.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C11H20NO3Si.CH4O3S/c1-12-9-6-5-7-11(12)8-10-16(13-2,14-3)15-4;1-5(2,3)4/h5-7,9H,8,10H2,1-4H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | IZYMGZSYDVIPOW-UHFFFAOYSA-M |
| XLogP | 0.09 |
| TPSA | 88.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|