C20H12O — CID 86654524
17-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1,3,5,7,9,11,13,15,18,20-decaene (PubChem CID 86654524) has the molecular formula C20H12O and a molecular weight of 268.31 g/mol. Its IUPAC name is 17-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1,3,5,7,9,11,13,15,18,20-decaene.
| Compound Name | 17-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1,3,5,7,9,11,13,15,18,20-decaene |
|---|---|
| PubChem CID | 86654524 |
| Molecular Formula | C20H12O |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 17-oxapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1,3,5,7,9,11,13,15,18,20-decaene |
| SMILES | c1ccc2c(c1)cc1c2ccc2ccc3occcc3c21 |
| InChI | InChI=1S/C20H12O/c1-2-5-15-14(4-1)12-18-16(15)9-7-13-8-10-19-17(20(13)18)6-3-11-21-19/h1-12H |
| InChIKey | UEOGLANRPZAEAC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|