C20H38N4O4S — CID 86654827
bis(2-methyl-1,3-dipropylimidazol-1-ium);sulfate (PubChem CID 86654827) has the molecular formula C20H38N4O4S and a molecular weight of 430.62 g/mol. Its IUPAC name is bis(2-methyl-1,3-dipropylimidazol-1-ium);sulfate.
| Compound Name | bis(2-methyl-1,3-dipropylimidazol-1-ium);sulfate |
|---|---|
| PubChem CID | 86654827 |
| Molecular Formula | C20H38N4O4S |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | bis(2-methyl-1,3-dipropylimidazol-1-ium);sulfate |
| SMILES | CCCn1cc[n+](CCC)c1C.CCCn1cc[n+](CCC)c1C.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C10H19N2.H2O4S/c2*1-4-6-11-8-9-12(7-5-2)10(11)3;1-5(2,3)4/h2*8-9H,4-7H2,1-3H3;(H2,1,2,3,4)/q2*+1;/p-2 |
| InChIKey | BPIBNHDFGBINDT-UHFFFAOYSA-L |
| XLogP | 2.47 |
| TPSA | 97.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|