C29H24F4O5S2 — CID 86654882
4-benzoyloxy-1,1,2,2-tetrafluorobutane-1-sulfonate;triphenylsulfanium (PubChem CID 86654882) has the molecular formula C29H24F4O5S2 and a molecular weight of 592.63 g/mol. Its IUPAC name is 4-benzoyloxy-1,1,2,2-tetrafluorobutane-1-sulfonate;triphenylsulfanium.
| Compound Name | 4-benzoyloxy-1,1,2,2-tetrafluorobutane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 86654882 |
| Molecular Formula | C29H24F4O5S2 |
| Molecular Weight | 592.63 g/mol |
| Exact Mass | 592.10 |
| IUPAC Name | 4-benzoyloxy-1,1,2,2-tetrafluorobutane-1-sulfonate;triphenylsulfanium |
| SMILES | O=C(OCCC(F)(F)C(F)(F)S(=O)(=O)[O-])c1ccccc1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C11H10F4O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;12-10(13,11(14,15)21(17,18)19)6-7-20-9(16)8-4-2-1-3-5-8/h1-15H;1-5H,6-7H2,(H,17,18,19)/q+1;/p-1 |
| InChIKey | DQIUMSBICJJHLO-UHFFFAOYSA-M |
| XLogP | 6.79 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.63 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|