C28H37F2N5O3 — CID 86655031
tert-butyl 2-[4-[4-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxyiminopiperidin-1-yl]-2,5-difluorophenyl]acetate (PubChem CID 86655031) has the molecular formula C28H37F2N5O3 and a molecular weight of 529.63 g/mol. Its IUPAC name is tert-butyl 2-[4-[4-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxyiminopiperidin-1-yl]-2,5-difluorophenyl]acetate.
| Compound Name | tert-butyl 2-[4-[4-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxyiminopiperidin-1-yl]-2,5-difluorophenyl]acetate |
|---|---|
| PubChem CID | 86655031 |
| Molecular Formula | C28H37F2N5O3 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | tert-butyl 2-[4-[4-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxyiminopiperidin-1-yl]-2,5-difluorophenyl]acetate |
| SMILES | CCc1cnc(N2CCC(ON=C3CCN(c4cc(F)c(CC(=O)OC(C)(C)C)cc4F)CC3)CC2)nc1 |
| InChI | InChI=1S/C28H37F2N5O3/c1-5-19-17-31-27(32-18-19)35-12-8-22(9-13-35)38-33-21-6-10-34(11-7-21)25-16-23(29)20(14-24(25)30)15-26(36)37-28(2,3)4/h14,16-18,22H,5-13,15H2,1-4H3 |
| InChIKey | YLMTYIUIRZWUQQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 80.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|