C29H28F4O6S2 — CID 86655551
1,1,4,4-tetrafluoro-5-(2-methylprop-2-enoyloxy)-3-oxoheptane-1-sulfonate;triphenylsulfanium (PubChem CID 86655551) has the molecular formula C29H28F4O6S2 and a molecular weight of 612.66 g/mol. Its IUPAC name is 1,1,4,4-tetrafluoro-5-(2-methylprop-2-enoyloxy)-3-oxoheptane-1-sulfonate;triphenylsulfanium.
| Compound Name | 1,1,4,4-tetrafluoro-5-(2-methylprop-2-enoyloxy)-3-oxoheptane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 86655551 |
| Molecular Formula | C29H28F4O6S2 |
| Molecular Weight | 612.66 g/mol |
| Exact Mass | 612.13 |
| IUPAC Name | 1,1,4,4-tetrafluoro-5-(2-methylprop-2-enoyloxy)-3-oxoheptane-1-sulfonate;triphenylsulfanium |
| SMILES | C=C(C)C(=O)OC(CC)C(F)(F)C(=O)CC(F)(F)S(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C11H14F4O6S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4-8(21-9(17)6(2)3)11(14,15)7(16)5-10(12,13)22(18,19)20/h1-15H;8H,2,4-5H2,1,3H3,(H,18,19,20)/q+1;/p-1 |
| InChIKey | NCKKXMFAEYALKK-UHFFFAOYSA-M |
| XLogP | 6.40 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.66 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|